| Name | 3,3-Diphenylpropionic acid |
| Synonyms | Benzhydrylaceticacid Benzhydrylacetic acid 3,3-diphenylpropanoate Diphenylpropionic acid 3,3-Dipenylpropionicacid 3,3-Diphenylpropanoicacid 3,3-Dipenylpropionic Acid 3,3-Diphenylpropanoic acid 3,3-Diphenylpropionic acid beta-phenyl-benzenepropanoicaci beta-Phenylbenzenepropanoic acid |
| CAS | 606-83-7 |
| EINECS | 210-125-4 |
| InChI | InChI=1/C15H14O2/c16-15(17)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,16,17) |
| InChIKey | BZQGAPWJKAYCHR-UHFFFAOYSA-N |
| Molecular Formula | C15H14O2 |
| Molar Mass | 226.27 |
| Density | 1.0891 (rough estimate) |
| Melting Point | 151-154 °C (lit.) |
| Boling Point | 327.88°C (rough estimate) |
| Flash Point | 113 °C |
| Water Solubility | slightly soluble |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Appearance | White solid |
| Color | White to light yellow |
| BRN | 1912506 |
| pKa | 4.45±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.6530 (estimate) |
| MDL | MFCD00002717 |
| Physical and Chemical Properties | Appearance: White Crystal Melting Point: 151-155 ℃ |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29163990 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for pharmaceutical intermediates |
| production method | derived from the alkylation of cinnamic acid with benzene in the presence of anhydrous aluminum trichloride. |